C18H26F3N5O — CID 111316484
2-[[N'-methyl-N-(1-propan-2-ylpiperidin-4-yl)carbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 111316484) has the molecular formula C18H26F3N5O and a molecular weight of 385.43 g/mol. Its IUPAC name is 2-[[N'-methyl-N-(1-propan-2-ylpiperidin-4-yl)carbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[N'-methyl-N-(1-propan-2-ylpiperidin-4-yl)carbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 111316484 |
| Molecular Formula | C18H26F3N5O |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 2-[[N'-methyl-N-(1-propan-2-ylpiperidin-4-yl)carbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | C/N=C(\NCC(=O)Nc1ccc(F)c(F)c1F)NC1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C18H26F3N5O/c1-11(2)26-8-6-12(7-9-26)24-18(22-3)23-10-15(27)25-14-5-4-13(19)16(20)17(14)21/h4-5,11-12H,6-10H2,1-3H3,(H,25,27)(H2,22,23,24) |
| InChIKey | RJUKTYRTYJCZNE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|