C20H21F5IN5O — CID 111921102
2-[[N-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide (PubChem CID 111921102) has the molecular formula C20H21F5IN5O and a molecular weight of 569.32 g/mol. Its IUPAC name is 2-[[N-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[N-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111921102 |
| Molecular Formula | C20H21F5IN5O |
| Molecular Weight | 569.32 g/mol |
| Exact Mass | 569.07 |
| IUPAC Name | 2-[[N-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)Nc1ccc(F)c(F)c1F)NC1CCN(c2ccc(F)cc2F)C1.I |
| InChI | InChI=1S/C20H20F5N5O.HI/c1-26-20(27-9-17(31)29-15-4-3-13(22)18(24)19(15)25)28-12-6-7-30(10-12)16-5-2-11(21)8-14(16)23;/h2-5,8,12H,6-7,9-10H2,1H3,(H,29,31)(H2,26,27,28);1H |
| InChIKey | MIAPPRLTICTYPW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|