C20H32FN5O — CID 111317130
3-fluoro-4-methyl-N-[2-[[N'-methyl-N-(1-propan-2-ylpiperidin-4-yl)carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111317130) has the molecular formula C20H32FN5O and a molecular weight of 377.51 g/mol. Its IUPAC name is 3-fluoro-4-methyl-N-[2-[[N'-methyl-N-(1-propan-2-ylpiperidin-4-yl)carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | 3-fluoro-4-methyl-N-[2-[[N'-methyl-N-(1-propan-2-ylpiperidin-4-yl)carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111317130 |
| Molecular Formula | C20H32FN5O |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | 3-fluoro-4-methyl-N-[2-[[N'-methyl-N-(1-propan-2-ylpiperidin-4-yl)carbamimidoyl]amino]ethyl]benzamide |
| SMILES | C/N=C(\NCCNC(=O)c1ccc(C)c(F)c1)NC1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C20H32FN5O/c1-14(2)26-11-7-17(8-12-26)25-20(22-4)24-10-9-23-19(27)16-6-5-15(3)18(21)13-16/h5-6,13-14,17H,7-12H2,1-4H3,(H,23,27)(H2,22,24,25) |
| InChIKey | VWWFLTJOFJUAOF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|