C17H30IN5O2 — CID 111316939
N-[2-[[N'-methyl-N-(1-propan-2-ylpiperidin-4-yl)carbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide (PubChem CID 111316939) has the molecular formula C17H30IN5O2 and a molecular weight of 463.36 g/mol. Its IUPAC name is N-[2-[[N'-methyl-N-(1-propan-2-ylpiperidin-4-yl)carbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N'-methyl-N-(1-propan-2-ylpiperidin-4-yl)carbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111316939 |
| Molecular Formula | C17H30IN5O2 |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | N-[2-[[N'-methyl-N-(1-propan-2-ylpiperidin-4-yl)carbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)c1ccco1)NC1CCN(C(C)C)CC1.I |
| InChI | InChI=1S/C17H29N5O2.HI/c1-13(2)22-10-6-14(7-11-22)21-17(18-3)20-9-8-19-16(23)15-5-4-12-24-15;/h4-5,12-14H,6-11H2,1-3H3,(H,19,23)(H2,18,20,21);1H |
| InChIKey | OPXZFOOIBDFIJB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 81.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|