C14H16FN3O2 — CID 104781003
1-[3-(3-aminoprop-1-ynyl)-4-fluorophenyl]-3-(oxolan-3-yl)urea (PubChem CID 104781003) has the molecular formula C14H16FN3O2 and a molecular weight of 277.30 g/mol. Its IUPAC name is 1-[3-(3-aminoprop-1-ynyl)-4-fluorophenyl]-3-(oxolan-3-yl)urea.
| Compound Name | 1-[3-(3-aminoprop-1-ynyl)-4-fluorophenyl]-3-(oxolan-3-yl)urea |
|---|---|
| PubChem CID | 104781003 |
| Molecular Formula | C14H16FN3O2 |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 1-[3-(3-aminoprop-1-ynyl)-4-fluorophenyl]-3-(oxolan-3-yl)urea |
| SMILES | NCC#Cc1cc(NC(=O)NC2CCOC2)ccc1F |
| InChI | InChI=1S/C14H16FN3O2/c15-13-4-3-11(8-10(13)2-1-6-16)17-14(19)18-12-5-7-20-9-12/h3-4,8,12H,5-7,9,16H2,(H2,17,18,19) |
| InChIKey | XUTPFROOKIHCJV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|