C14H17FN2O4 — CID 107796245
2-fluoro-4-[(2-hydroxycyclohexyl)carbamoylamino]benzoic acid (PubChem CID 107796245) has the molecular formula C14H17FN2O4 and a molecular weight of 296.30 g/mol. Its IUPAC name is 2-fluoro-4-[(2-hydroxycyclohexyl)carbamoylamino]benzoic acid.
| Compound Name | 2-fluoro-4-[(2-hydroxycyclohexyl)carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 107796245 |
| Molecular Formula | C14H17FN2O4 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 2-fluoro-4-[(2-hydroxycyclohexyl)carbamoylamino]benzoic acid |
| SMILES | O=C(Nc1ccc(C(=O)O)c(F)c1)NC1CCCCC1O |
| InChI | InChI=1S/C14H17FN2O4/c15-10-7-8(5-6-9(10)13(19)20)16-14(21)17-11-3-1-2-4-12(11)18/h5-7,11-12,18H,1-4H2,(H,19,20)(H2,16,17,21) |
| InChIKey | ACFKEYOCCKHNKT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |