C13H15FN2O3S — CID 107796478
2-fluoro-4-(thian-3-ylcarbamoylamino)benzoic acid (PubChem CID 107796478) has the molecular formula C13H15FN2O3S and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-fluoro-4-(thian-3-ylcarbamoylamino)benzoic acid.
| Compound Name | 2-fluoro-4-(thian-3-ylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 107796478 |
| Molecular Formula | C13H15FN2O3S |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-fluoro-4-(thian-3-ylcarbamoylamino)benzoic acid |
| SMILES | O=C(Nc1ccc(C(=O)O)c(F)c1)NC1CCCSC1 |
| InChI | InChI=1S/C13H15FN2O3S/c14-11-6-8(3-4-10(11)12(17)18)15-13(19)16-9-2-1-5-20-7-9/h3-4,6,9H,1-2,5,7H2,(H,17,18)(H2,15,16,19) |
| InChIKey | CMTGJHXZFZFWME-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |