C13H15FN2O4 — CID 107796002
2-fluoro-4-(oxan-4-ylcarbamoylamino)benzoic acid (PubChem CID 107796002) has the molecular formula C13H15FN2O4 and a molecular weight of 282.27 g/mol. Its IUPAC name is 2-fluoro-4-(oxan-4-ylcarbamoylamino)benzoic acid.
| Compound Name | 2-fluoro-4-(oxan-4-ylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 107796002 |
| Molecular Formula | C13H15FN2O4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-fluoro-4-(oxan-4-ylcarbamoylamino)benzoic acid |
| SMILES | O=C(Nc1ccc(C(=O)O)c(F)c1)NC1CCOCC1 |
| InChI | InChI=1S/C13H15FN2O4/c14-11-7-9(1-2-10(11)12(17)18)16-13(19)15-8-3-5-20-6-4-8/h1-2,7-8H,3-6H2,(H,17,18)(H2,15,16,19) |
| InChIKey | CNVMHCGANBZTHR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |