C10H8F3NOS3 — CID 716822
N-(2,3,4-trifluorophenyl)-1,3,5-trithiane-2-carboxamide (PubChem CID 716822) has the molecular formula C10H8F3NOS3 and a molecular weight of 311.38 g/mol. Its IUPAC name is N-(2,3,4-trifluorophenyl)-1,3,5-trithiane-2-carboxamide.
| Compound Name | N-(2,3,4-trifluorophenyl)-1,3,5-trithiane-2-carboxamide |
|---|---|
| PubChem CID | 716822 |
| Molecular Formula | C10H8F3NOS3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 310.97 |
| IUPAC Name | N-(2,3,4-trifluorophenyl)-1,3,5-trithiane-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)C1SCSCS1 |
| InChI | InChI=1S/C10H8F3NOS3/c11-5-1-2-6(8(13)7(5)12)14-9(15)10-17-3-16-4-18-10/h1-2,10H,3-4H2,(H,14,15) |
| InChIKey | WJVATDFVZBPVIB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|