C14H17F3N2O — CID 108892509
3,5-dimethyl-N-(2,3,4-trifluorophenyl)piperidine-1-carboxamide (PubChem CID 108892509) has the molecular formula C14H17F3N2O and a molecular weight of 286.30 g/mol. Its IUPAC name is 3,5-dimethyl-N-(2,3,4-trifluorophenyl)piperidine-1-carboxamide.
| Compound Name | 3,5-dimethyl-N-(2,3,4-trifluorophenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 108892509 |
| Molecular Formula | C14H17F3N2O |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 3,5-dimethyl-N-(2,3,4-trifluorophenyl)piperidine-1-carboxamide |
| SMILES | CC1CC(C)CN(C(=O)Nc2ccc(F)c(F)c2F)C1 |
| InChI | InChI=1S/C14H17F3N2O/c1-8-5-9(2)7-19(6-8)14(20)18-11-4-3-10(15)12(16)13(11)17/h3-4,8-9H,5-7H2,1-2H3,(H,18,20) |
| InChIKey | OMFHLZPEOOZPTR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|