C18H24F3N3O2 — CID 26495308
(2S)-2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide (PubChem CID 26495308) has the molecular formula C18H24F3N3O2 and a molecular weight of 371.40 g/mol. Its IUPAC name is (2S)-2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide.
| Compound Name | (2S)-2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide |
|---|---|
| PubChem CID | 26495308 |
| Molecular Formula | C18H24F3N3O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | (2S)-2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide |
| SMILES | C[C@@H]1C[C@H](C)CN([C@@H](C)C(=O)NCC(=O)Nc2ccc(F)c(F)c2F)C1 |
| InChI | InChI=1S/C18H24F3N3O2/c1-10-6-11(2)9-24(8-10)12(3)18(26)22-7-15(25)23-14-5-4-13(19)16(20)17(14)21/h4-5,10-12H,6-9H2,1-3H3,(H,22,26)(H,23,25)/t10-,11+,12-/m0/s1 |
| InChIKey | JUOQKGNWVQVFCM-TUAOUCFPSA-N |
| XLogP | 2.53 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|