C20H22F3N5O4S — CID 55680040
N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2-(4-pyridin-3-ylsulfonylpiperazin-1-yl)propanamide (PubChem CID 55680040) has the molecular formula C20H22F3N5O4S and a molecular weight of 485.49 g/mol. Its IUPAC name is N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2-(4-pyridin-3-ylsulfonylpiperazin-1-yl)propanamide.
| Compound Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2-(4-pyridin-3-ylsulfonylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 55680040 |
| Molecular Formula | C20H22F3N5O4S |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2-(4-pyridin-3-ylsulfonylpiperazin-1-yl)propanamide |
| SMILES | CC(C(=O)NCC(=O)Nc1ccc(F)c(F)c1F)N1CCN(S(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C20H22F3N5O4S/c1-13(20(30)25-12-17(29)26-16-5-4-15(21)18(22)19(16)23)27-7-9-28(10-8-27)33(31,32)14-3-2-6-24-11-14/h2-6,11,13H,7-10,12H2,1H3,(H,25,30)(H,26,29) |
| InChIKey | HMIGRYAIJBVWJG-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|