C11H11F3N2O — CID 64617943
2-(azetidin-3-yl)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 64617943) has the molecular formula C11H11F3N2O and a molecular weight of 244.22 g/mol. Its IUPAC name is 2-(azetidin-3-yl)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(azetidin-3-yl)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 64617943 |
| Molecular Formula | C11H11F3N2O |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2-(azetidin-3-yl)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CC1CNC1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H11F3N2O/c12-7-1-2-8(11(14)10(7)13)16-9(17)3-6-4-15-5-6/h1-2,6,15H,3-5H2,(H,16,17) |
| InChIKey | LFSPRAGPCIKRAS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|