C15H16F3NO — CID 7769996
2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 7769996) has the molecular formula C15H16F3NO and a molecular weight of 283.29 g/mol. Its IUPAC name is 2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 7769996 |
| Molecular Formula | C15H16F3NO |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(C[C@@H]1C[C@H]2CC[C@H]1C2)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H16F3NO/c16-11-3-4-12(15(18)14(11)17)19-13(20)7-10-6-8-1-2-9(10)5-8/h3-4,8-10H,1-2,5-7H2,(H,19,20)/t8-,9-,10-/m0/s1 |
| InChIKey | LKZIMGKGLPPHDV-GUBZILKMSA-N |
| XLogP | 3.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|