C15H18INO — CID 18556276
2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-N-(2-iodophenyl)acetamide (PubChem CID 18556276) has the molecular formula C15H18INO and a molecular weight of 355.22 g/mol. Its IUPAC name is 2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-N-(2-iodophenyl)acetamide.
| Compound Name | 2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-N-(2-iodophenyl)acetamide |
|---|---|
| PubChem CID | 18556276 |
| Molecular Formula | C15H18INO |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-N-(2-iodophenyl)acetamide |
| SMILES | O=C(C[C@H]1C[C@@H]2CC[C@@H]1C2)Nc1ccccc1I |
| InChI | InChI=1S/C15H18INO/c16-13-3-1-2-4-14(13)17-15(18)9-12-8-10-5-6-11(12)7-10/h1-4,10-12H,5-9H2,(H,17,18)/t10-,11-,12-/m1/s1 |
| InChIKey | KRFMLHOMHXBERT-IJLUTSLNSA-N |
| XLogP | 4.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|