C17H23NO — CID 7923830
2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N-(2-ethylphenyl)acetamide (PubChem CID 7923830) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 7923830 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N-(2-ethylphenyl)acetamide |
| SMILES | CCc1ccccc1NC(=O)C[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C17H23NO/c1-2-13-5-3-4-6-16(13)18-17(19)11-15-10-12-7-8-14(15)9-12/h3-6,12,14-15H,2,7-11H2,1H3,(H,18,19)/t12-,14-,15+/m0/s1 |
| InChIKey | ZPVHZTNYVLRJTQ-AEGPPILISA-N |
| XLogP | 4.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |