C17H22N2O2 — CID 11914325
N-(4-acetamidophenyl)-2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetamide (PubChem CID 11914325) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetamide.
| Compound Name | N-(4-acetamidophenyl)-2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetamide |
|---|---|
| PubChem CID | 11914325 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | N-(4-acetamidophenyl)-2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)C[C@@H]2C[C@H]3CC[C@@H]2C3)cc1 |
| InChI | InChI=1S/C17H22N2O2/c1-11(20)18-15-4-6-16(7-5-15)19-17(21)10-14-9-12-2-3-13(14)8-12/h4-7,12-14H,2-3,8-10H2,1H3,(H,18,20)(H,19,21)/t12-,13+,14-/m0/s1 |
| InChIKey | MYXAEUPNLPUNSE-MJBXVCDLSA-N |
| XLogP | 3.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |