C19H28N2O3S — CID 21175312
2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-N-[4-(diethylsulfamoyl)phenyl]acetamide (PubChem CID 21175312) has the molecular formula C19H28N2O3S and a molecular weight of 364.51 g/mol. Its IUPAC name is 2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-N-[4-(diethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-N-[4-(diethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 21175312 |
| Molecular Formula | C19H28N2O3S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-N-[4-(diethylsulfamoyl)phenyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)C[C@H]2C[C@@H]3CC[C@@H]2C3)cc1 |
| InChI | InChI=1S/C19H28N2O3S/c1-3-21(4-2)25(23,24)18-9-7-17(8-10-18)20-19(22)13-16-12-14-5-6-15(16)11-14/h7-10,14-16H,3-6,11-13H2,1-2H3,(H,20,22)/t14-,15-,16-/m1/s1 |
| InChIKey | ZIXRGEDTZMORKN-BZUAXINKSA-N |
| XLogP | 3.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |