C19H26N2O3S — CID 78863206
2-(2-bicyclo[2.2.1]heptanyl)-N-[4-(cyclopropylmethylsulfamoyl)phenyl]acetamide (PubChem CID 78863206) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-N-[4-(cyclopropylmethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-N-[4-(cyclopropylmethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 78863206 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-N-[4-(cyclopropylmethylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(CC1CC2CCC1C2)Nc1ccc(S(=O)(=O)NCC2CC2)cc1 |
| InChI | InChI=1S/C19H26N2O3S/c22-19(11-16-10-14-3-4-15(16)9-14)21-17-5-7-18(8-6-17)25(23,24)20-12-13-1-2-13/h5-8,13-16,20H,1-4,9-12H2,(H,21,22) |
| InChIKey | QZVQTZXFEQIBEH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |