C16H20N2O3 — CID 21175281
2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-N-(2-methyl-3-nitrophenyl)acetamide (PubChem CID 21175281) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-N-(2-methyl-3-nitrophenyl)acetamide.
| Compound Name | 2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-N-(2-methyl-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 21175281 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-N-(2-methyl-3-nitrophenyl)acetamide |
| SMILES | Cc1c(NC(=O)C[C@@H]2C[C@@H]3CC[C@@H]2C3)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H20N2O3/c1-10-14(3-2-4-15(10)18(20)21)17-16(19)9-13-8-11-5-6-12(13)7-11/h2-4,11-13H,5-9H2,1H3,(H,17,19)/t11-,12-,13+/m1/s1 |
| InChIKey | JVFZNLKEHWCYMI-UPJWGTAASA-N |
| XLogP | 3.67 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|