C19H24N2O4 — CID 9270815
2-[(5S,7R)-3-hydroxy-1-adamantyl]-N-(2-methyl-3-nitrophenyl)acetamide (PubChem CID 9270815) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-[(5S,7R)-3-hydroxy-1-adamantyl]-N-(2-methyl-3-nitrophenyl)acetamide.
| Compound Name | 2-[(5S,7R)-3-hydroxy-1-adamantyl]-N-(2-methyl-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 9270815 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2-[(5S,7R)-3-hydroxy-1-adamantyl]-N-(2-methyl-3-nitrophenyl)acetamide |
| SMILES | Cc1c(NC(=O)CC23C[C@@H]4C[C@@H](CC(O)(C4)C2)C3)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H24N2O4/c1-12-15(3-2-4-16(12)21(24)25)20-17(22)10-18-6-13-5-14(7-18)9-19(23,8-13)11-18/h2-4,13-14,23H,5-11H2,1H3,(H,20,22)/t13-,14+,18?,19? |
| InChIKey | OHNNKJVIONLGJG-BAUKFBFWSA-N |
| XLogP | 3.56 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|