C23H32N2O3 — CID 42942168
N-[3-[[2-(3-hydroxy-1-adamantyl)acetyl]amino]phenyl]-2,2-dimethylpropanamide (PubChem CID 42942168) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is N-[3-[[2-(3-hydroxy-1-adamantyl)acetyl]amino]phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-[[2-(3-hydroxy-1-adamantyl)acetyl]amino]phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 42942168 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | N-[3-[[2-(3-hydroxy-1-adamantyl)acetyl]amino]phenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1cccc(NC(=O)CC23CC4CC(CC(O)(C4)C2)C3)c1 |
| InChI | InChI=1S/C23H32N2O3/c1-21(2,3)20(27)25-18-6-4-5-17(8-18)24-19(26)13-22-9-15-7-16(10-22)12-23(28,11-15)14-22/h4-6,8,15-16,28H,7,9-14H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | IWLFKASYNPUWSE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |