C19H29N3O2 — CID 102554342
N-(1-tert-butylpyrazol-4-yl)-2-(3-hydroxy-1-adamantyl)acetamide (PubChem CID 102554342) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is N-(1-tert-butylpyrazol-4-yl)-2-(3-hydroxy-1-adamantyl)acetamide.
| Compound Name | N-(1-tert-butylpyrazol-4-yl)-2-(3-hydroxy-1-adamantyl)acetamide |
|---|---|
| PubChem CID | 102554342 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | N-(1-tert-butylpyrazol-4-yl)-2-(3-hydroxy-1-adamantyl)acetamide |
| SMILES | CC(C)(C)n1cc(NC(=O)CC23CC4CC(CC(O)(C4)C2)C3)cn1 |
| InChI | InChI=1S/C19H29N3O2/c1-17(2,3)22-11-15(10-20-22)21-16(23)9-18-5-13-4-14(6-18)8-19(24,7-13)12-18/h10-11,13-14,24H,4-9,12H2,1-3H3,(H,21,23) |
| InChIKey | FCYKOVSAXHGMFY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |