C21H27NO4 — CID 9378234
methyl 3-[[2-[(5S,7R)-3-hydroxy-1-adamantyl]acetyl]amino]-4-methylbenzoate (PubChem CID 9378234) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is methyl 3-[[2-[(5S,7R)-3-hydroxy-1-adamantyl]acetyl]amino]-4-methylbenzoate.
| Compound Name | methyl 3-[[2-[(5S,7R)-3-hydroxy-1-adamantyl]acetyl]amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 9378234 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | methyl 3-[[2-[(5S,7R)-3-hydroxy-1-adamantyl]acetyl]amino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)CC23C[C@@H]4C[C@@H](CC(O)(C4)C2)C3)c1 |
| InChI | InChI=1S/C21H27NO4/c1-13-3-4-16(19(24)26-2)6-17(13)22-18(23)11-20-7-14-5-15(8-20)10-21(25,9-14)12-20/h3-4,6,14-15,25H,5,7-12H2,1-2H3,(H,22,23)/t14-,15+,20?,21? |
| InChIKey | IHPKGRZLWAMAMP-XFKLWTPLSA-N |
| XLogP | 3.44 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |