C22H30N2O3 — CID 17421165
N-[2-(2,6-dimethylanilino)-2-oxoethyl]-2-(3-hydroxy-1-adamantyl)acetamide (PubChem CID 17421165) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is N-[2-(2,6-dimethylanilino)-2-oxoethyl]-2-(3-hydroxy-1-adamantyl)acetamide.
| Compound Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-2-(3-hydroxy-1-adamantyl)acetamide |
|---|---|
| PubChem CID | 17421165 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-2-(3-hydroxy-1-adamantyl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CNC(=O)CC12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C22H30N2O3/c1-14-4-3-5-15(2)20(14)24-19(26)12-23-18(25)11-21-7-16-6-17(8-21)10-22(27,9-16)13-21/h3-5,16-17,27H,6-13H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | USRLKMUEPMLRAJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |