C19H25NO3 — CID 24540776
2-(3-hydroxy-1-adamantyl)-N-(2-hydroxy-4-methylphenyl)acetamide (PubChem CID 24540776) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 2-(3-hydroxy-1-adamantyl)-N-(2-hydroxy-4-methylphenyl)acetamide.
| Compound Name | 2-(3-hydroxy-1-adamantyl)-N-(2-hydroxy-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 24540776 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 2-(3-hydroxy-1-adamantyl)-N-(2-hydroxy-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CC23CC4CC(CC(O)(C4)C2)C3)c(O)c1 |
| InChI | InChI=1S/C19H25NO3/c1-12-2-3-15(16(21)4-12)20-17(22)10-18-6-13-5-14(7-18)9-19(23,8-13)11-18/h2-4,13-14,21,23H,5-11H2,1H3,(H,20,22) |
| InChIKey | ONXRSDZWFNSYMM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|