C23H32N2O5S — CID 98320891
2-[(5R,7R)-3-hydroxy-1-adamantyl]-N-(2-hydroxy-5-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 98320891) has the molecular formula C23H32N2O5S and a molecular weight of 448.59 g/mol. Its IUPAC name is 2-[(5R,7R)-3-hydroxy-1-adamantyl]-N-(2-hydroxy-5-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[(5R,7R)-3-hydroxy-1-adamantyl]-N-(2-hydroxy-5-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 98320891 |
| Molecular Formula | C23H32N2O5S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 2-[(5R,7R)-3-hydroxy-1-adamantyl]-N-(2-hydroxy-5-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | O=C(CC12C[C@H]3C[C@@H](CC(O)(C3)C1)C2)Nc1cc(S(=O)(=O)N2CCCCC2)ccc1O |
| InChI | InChI=1S/C23H32N2O5S/c26-20-5-4-18(31(29,30)25-6-2-1-3-7-25)9-19(20)24-21(27)14-22-10-16-8-17(11-22)13-23(28,12-16)15-22/h4-5,9,16-17,26,28H,1-3,6-8,10-15H2,(H,24,27)/t16-,17-,22?,23?/m1/s1 |
| InChIKey | AEJMPWVRLIUPEA-TWVWUCKLSA-N |
| XLogP | 3.23 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|