C22H30N2O4S — CID 9368840
1-[4-(benzenesulfonyl)piperazin-1-yl]-2-[(5S,7R)-3-hydroxy-1-adamantyl]ethanone (PubChem CID 9368840) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is 1-[4-(benzenesulfonyl)piperazin-1-yl]-2-[(5S,7R)-3-hydroxy-1-adamantyl]ethanone.
| Compound Name | 1-[4-(benzenesulfonyl)piperazin-1-yl]-2-[(5S,7R)-3-hydroxy-1-adamantyl]ethanone |
|---|---|
| PubChem CID | 9368840 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 1-[4-(benzenesulfonyl)piperazin-1-yl]-2-[(5S,7R)-3-hydroxy-1-adamantyl]ethanone |
| SMILES | O=C(CC12C[C@@H]3C[C@@H](CC(O)(C3)C1)C2)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H30N2O4S/c25-20(15-21-11-17-10-18(12-21)14-22(26,13-17)16-21)23-6-8-24(9-7-23)29(27,28)19-4-2-1-3-5-19/h1-5,17-18,26H,6-16H2/t17-,18+,21?,22? |
| InChIKey | KMLRJALSJUAALU-OTXOEQGISA-N |
| XLogP | 2.24 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |