C27H38BrN3O4S — CID 98394308
2-[(5R,7R)-3-bromo-1-adamantyl]-N-(5-morpholin-4-ylsulfonyl-2-piperidin-1-ylphenyl)acetamide (PubChem CID 98394308) has the molecular formula C27H38BrN3O4S and a molecular weight of 580.59 g/mol. Its IUPAC name is 2-[(5R,7R)-3-bromo-1-adamantyl]-N-(5-morpholin-4-ylsulfonyl-2-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[(5R,7R)-3-bromo-1-adamantyl]-N-(5-morpholin-4-ylsulfonyl-2-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 98394308 |
| Molecular Formula | C27H38BrN3O4S |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | 2-[(5R,7R)-3-bromo-1-adamantyl]-N-(5-morpholin-4-ylsulfonyl-2-piperidin-1-ylphenyl)acetamide |
| SMILES | O=C(CC12C[C@H]3C[C@@H](CC(Br)(C3)C1)C2)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C27H38BrN3O4S/c28-27-16-20-12-21(17-27)15-26(14-20,19-27)18-25(32)29-23-13-22(36(33,34)31-8-10-35-11-9-31)4-5-24(23)30-6-2-1-3-7-30/h4-5,13,20-21H,1-3,6-12,14-19H2,(H,29,32)/t20-,21-,26?,27?/m1/s1 |
| InChIKey | QZLHKJURLGUDPV-CUFNRJLSSA-N |
| XLogP | 4.76 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|