C20H27NO2 — CID 9034291
N-(2,5-dimethylphenyl)-2-[(5S,7R)-3-hydroxy-1-adamantyl]acetamide (PubChem CID 9034291) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-[(5S,7R)-3-hydroxy-1-adamantyl]acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-[(5S,7R)-3-hydroxy-1-adamantyl]acetamide |
|---|---|
| PubChem CID | 9034291 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-[(5S,7R)-3-hydroxy-1-adamantyl]acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)CC23C[C@@H]4C[C@@H](CC(O)(C4)C2)C3)c1 |
| InChI | InChI=1S/C20H27NO2/c1-13-3-4-14(2)17(5-13)21-18(22)11-19-7-15-6-16(8-19)10-20(23,9-15)12-19/h3-5,15-16,23H,6-12H2,1-2H3,(H,21,22)/t15-,16+,19?,20? |
| InChIKey | DISSOEQYFCTMMP-BANKROOTSA-N |
| XLogP | 3.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |