C23H32N2O3 — CID 42944699
N-[4-[[2-(3-hydroxy-1-adamantyl)acetyl]amino]phenyl]-3-methylbutanamide (PubChem CID 42944699) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is N-[4-[[2-(3-hydroxy-1-adamantyl)acetyl]amino]phenyl]-3-methylbutanamide.
| Compound Name | N-[4-[[2-(3-hydroxy-1-adamantyl)acetyl]amino]phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 42944699 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | N-[4-[[2-(3-hydroxy-1-adamantyl)acetyl]amino]phenyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1ccc(NC(=O)CC23CC4CC(CC(O)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C23H32N2O3/c1-15(2)7-20(26)24-18-3-5-19(6-4-18)25-21(27)13-22-9-16-8-17(10-22)12-23(28,11-16)14-22/h3-6,15-17,28H,7-14H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | FVGKJNMJJXCLRQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |