C23H33N3O2 — CID 9358459
(2S)-2-(1-adamantylamino)-N-[2-(2,6-dimethylanilino)-2-oxoethyl]propanamide (PubChem CID 9358459) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is (2S)-2-(1-adamantylamino)-N-[2-(2,6-dimethylanilino)-2-oxoethyl]propanamide.
| Compound Name | (2S)-2-(1-adamantylamino)-N-[2-(2,6-dimethylanilino)-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 9358459 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | (2S)-2-(1-adamantylamino)-N-[2-(2,6-dimethylanilino)-2-oxoethyl]propanamide |
| SMILES | Cc1cccc(C)c1NC(=O)CNC(=O)[C@H](C)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H33N3O2/c1-14-5-4-6-15(2)21(14)25-20(27)13-24-22(28)16(3)26-23-10-17-7-18(11-23)9-19(8-17)12-23/h4-6,16-19,26H,7-13H2,1-3H3,(H,24,28)(H,25,27)/t16-,17?,18?,19?,23?/m0/s1 |
| InChIKey | WEHKJRGVRYBWBS-LXGFQCHUSA-N |
| XLogP | 3.31 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |