C13H13Cl2NO3 — CID 7920453
methyl 3-[[(1S)-2,2-dichlorocyclopropanecarbonyl]amino]-4-methylbenzoate (PubChem CID 7920453) has the molecular formula C13H13Cl2NO3 and a molecular weight of 302.16 g/mol. Its IUPAC name is methyl 3-[[(1S)-2,2-dichlorocyclopropanecarbonyl]amino]-4-methylbenzoate.
| Compound Name | methyl 3-[[(1S)-2,2-dichlorocyclopropanecarbonyl]amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 7920453 |
| Molecular Formula | C13H13Cl2NO3 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | methyl 3-[[(1S)-2,2-dichlorocyclopropanecarbonyl]amino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)[C@@H]2CC2(Cl)Cl)c1 |
| InChI | InChI=1S/C13H13Cl2NO3/c1-7-3-4-8(12(18)19-2)5-10(7)16-11(17)9-6-13(9,14)15/h3-5,9H,6H2,1-2H3,(H,16,17)/t9-/m0/s1 |
| InChIKey | YCHQKCZPBYDWGY-VIFPVBQESA-N |
| XLogP | 2.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|