C23H27NO8 — CID 3000178
dimethyl 2-[[2-(3-hydroxyadamantane-1-carbonyl)oxyacetyl]amino]benzene-1,4-dicarboxylate (PubChem CID 3000178) has the molecular formula C23H27NO8 and a molecular weight of 445.47 g/mol. Its IUPAC name is dimethyl 2-[[2-(3-hydroxyadamantane-1-carbonyl)oxyacetyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[2-(3-hydroxyadamantane-1-carbonyl)oxyacetyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 3000178 |
| Molecular Formula | C23H27NO8 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | dimethyl 2-[[2-(3-hydroxyadamantane-1-carbonyl)oxyacetyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)COC(=O)C23CC4CC(CC(O)(C4)C2)C3)c1 |
| InChI | InChI=1S/C23H27NO8/c1-30-19(26)15-3-4-16(20(27)31-2)17(6-15)24-18(25)11-32-21(28)22-7-13-5-14(8-22)10-23(29,9-13)12-22/h3-4,6,13-14,29H,5,7-12H2,1-2H3,(H,24,25) |
| InChIKey | INTPYHLXHFYVGB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|