C25H30N2O8 — CID 98365558
dimethyl 2-[[2-[(5R,7R)-3-acetamidoadamantane-1-carbonyl]oxyacetyl]amino]benzene-1,4-dicarboxylate (PubChem CID 98365558) has the molecular formula C25H30N2O8 and a molecular weight of 486.52 g/mol. Its IUPAC name is dimethyl 2-[[2-[(5R,7R)-3-acetamidoadamantane-1-carbonyl]oxyacetyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[2-[(5R,7R)-3-acetamidoadamantane-1-carbonyl]oxyacetyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 98365558 |
| Molecular Formula | C25H30N2O8 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | dimethyl 2-[[2-[(5R,7R)-3-acetamidoadamantane-1-carbonyl]oxyacetyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)COC(=O)C23C[C@H]4C[C@@H](CC(NC(C)=O)(C4)C2)C3)c1 |
| InChI | InChI=1S/C25H30N2O8/c1-14(28)27-25-10-15-6-16(11-25)9-24(8-15,13-25)23(32)35-12-20(29)26-19-7-17(21(30)33-2)4-5-18(19)22(31)34-3/h4-5,7,15-16H,6,8-13H2,1-3H3,(H,26,29)(H,27,28)/t15-,16-,24?,25?/m1/s1 |
| InChIKey | DBXHHBQEVLZHEO-KTYQWQPMSA-N |
| XLogP | 2.22 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|