C19H29N3O6 — CID 98218993
[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] (5R,7R)-3-acetamidoadamantane-1-carboxylate (PubChem CID 98218993) has the molecular formula C19H29N3O6 and a molecular weight of 395.46 g/mol. Its IUPAC name is [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] (5R,7R)-3-acetamidoadamantane-1-carboxylate.
| Compound Name | [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] (5R,7R)-3-acetamidoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 98218993 |
| Molecular Formula | C19H29N3O6 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] (5R,7R)-3-acetamidoadamantane-1-carboxylate |
| SMILES | COCCNC(=O)NC(=O)COC(=O)C12C[C@H]3C[C@@H](CC(NC(C)=O)(C3)C1)C2 |
| InChI | InChI=1S/C19H29N3O6/c1-12(23)22-19-8-13-5-14(9-19)7-18(6-13,11-19)16(25)28-10-15(24)21-17(26)20-3-4-27-2/h13-14H,3-11H2,1-2H3,(H,22,23)(H2,20,21,24,26)/t13-,14-,18?,19?/m1/s1 |
| InChIKey | HPTVAEOTRPXATO-CXTCDGGRSA-N |
| XLogP | 0.48 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|