C16H23BrN2O4 — CID 23350592
[2-(ethylcarbamoylamino)-2-oxoethyl] (5S,7S)-3-bromoadamantane-1-carboxylate (PubChem CID 23350592) has the molecular formula C16H23BrN2O4 and a molecular weight of 387.27 g/mol. Its IUPAC name is [2-(ethylcarbamoylamino)-2-oxoethyl] (5S,7S)-3-bromoadamantane-1-carboxylate.
| Compound Name | [2-(ethylcarbamoylamino)-2-oxoethyl] (5S,7S)-3-bromoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 23350592 |
| Molecular Formula | C16H23BrN2O4 |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | [2-(ethylcarbamoylamino)-2-oxoethyl] (5S,7S)-3-bromoadamantane-1-carboxylate |
| SMILES | CCNC(=O)NC(=O)COC(=O)C12C[C@@H]3C[C@H](CC(Br)(C3)C1)C2 |
| InChI | InChI=1S/C16H23BrN2O4/c1-2-18-14(22)19-12(20)8-23-13(21)15-4-10-3-11(5-15)7-16(17,6-10)9-15/h10-11H,2-9H2,1H3,(H2,18,19,20,22)/t10-,11-,15?,16?/m0/s1 |
| InChIKey | NGYKBCYQIQTFCQ-YXEONTRPSA-N |
| XLogP | 2.11 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|