C23H30N2O6 — CID 98365562
[2-(3,4-dimethoxyanilino)-2-oxoethyl] (5R,7R)-3-acetamidoadamantane-1-carboxylate (PubChem CID 98365562) has the molecular formula C23H30N2O6 and a molecular weight of 430.50 g/mol. Its IUPAC name is [2-(3,4-dimethoxyanilino)-2-oxoethyl] (5R,7R)-3-acetamidoadamantane-1-carboxylate.
| Compound Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] (5R,7R)-3-acetamidoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 98365562 |
| Molecular Formula | C23H30N2O6 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] (5R,7R)-3-acetamidoadamantane-1-carboxylate |
| SMILES | COc1ccc(NC(=O)COC(=O)C23C[C@H]4C[C@@H](CC(NC(C)=O)(C4)C2)C3)cc1OC |
| InChI | InChI=1S/C23H30N2O6/c1-14(26)25-23-10-15-6-16(11-23)9-22(8-15,13-23)21(28)31-12-20(27)24-17-4-5-18(29-2)19(7-17)30-3/h4-5,7,15-16H,6,8-13H2,1-3H3,(H,24,27)(H,25,26)/t15-,16-,22?,23?/m1/s1 |
| InChIKey | NUTYDIZGSWTGST-SNTCSEMISA-N |
| XLogP | 2.66 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |