C26H37N3O6S — CID 16544343
[2-[3-(diethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 3-acetamidoadamantane-1-carboxylate (PubChem CID 16544343) has the molecular formula C26H37N3O6S and a molecular weight of 519.66 g/mol. Its IUPAC name is [2-[3-(diethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 3-acetamidoadamantane-1-carboxylate.
| Compound Name | [2-[3-(diethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 3-acetamidoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 16544343 |
| Molecular Formula | C26H37N3O6S |
| Molecular Weight | 519.66 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | [2-[3-(diethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 3-acetamidoadamantane-1-carboxylate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)COC(=O)C23CC4CC(CC(NC(C)=O)(C4)C2)C3)ccc1C |
| InChI | InChI=1S/C26H37N3O6S/c1-5-29(6-2)36(33,34)22-10-21(8-7-17(22)3)27-23(31)15-35-24(32)25-11-19-9-20(12-25)14-26(13-19,16-25)28-18(4)30/h7-8,10,19-20H,5-6,9,11-16H2,1-4H3,(H,27,31)(H,28,30) |
| InChIKey | KDIOZQIHPJQJOU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.66 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |