C22H30N2O5S — CID 4307596
[2-[3-(dimethylsulfamoyl)-4-methylanilino]-2-oxoethyl] adamantane-1-carboxylate (PubChem CID 4307596) has the molecular formula C22H30N2O5S and a molecular weight of 434.56 g/mol. Its IUPAC name is [2-[3-(dimethylsulfamoyl)-4-methylanilino]-2-oxoethyl] adamantane-1-carboxylate.
| Compound Name | [2-[3-(dimethylsulfamoyl)-4-methylanilino]-2-oxoethyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 4307596 |
| Molecular Formula | C22H30N2O5S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | [2-[3-(dimethylsulfamoyl)-4-methylanilino]-2-oxoethyl] adamantane-1-carboxylate |
| SMILES | Cc1ccc(NC(=O)COC(=O)C23CC4CC(CC(C4)C2)C3)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C22H30N2O5S/c1-14-4-5-18(9-19(14)30(27,28)24(2)3)23-20(25)13-29-21(26)22-10-15-6-16(11-22)8-17(7-15)12-22/h4-5,9,15-17H,6-8,10-13H2,1-3H3,(H,23,25) |
| InChIKey | WNECYUPJCUFSHF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |