C20H24ClNO5 — CID 4843730
[2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 3-hydroxyadamantane-1-carboxylate (PubChem CID 4843730) has the molecular formula C20H24ClNO5 and a molecular weight of 393.87 g/mol. Its IUPAC name is [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 3-hydroxyadamantane-1-carboxylate.
| Compound Name | [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 3-hydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 4843730 |
| Molecular Formula | C20H24ClNO5 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 3-hydroxyadamantane-1-carboxylate |
| SMILES | COc1ccc(NC(=O)COC(=O)C23CC4CC(CC(O)(C4)C2)C3)cc1Cl |
| InChI | InChI=1S/C20H24ClNO5/c1-26-16-3-2-14(5-15(16)21)22-17(23)10-27-18(24)19-6-12-4-13(7-19)9-20(25,8-12)11-19/h2-3,5,12-13,25H,4,6-11H2,1H3,(H,22,23) |
| InChIKey | UTENLUJGDPORNR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |