C24H33N3O3 — CID 134027331
N-[3-[[[2-(1-adamantyl)acetyl]amino]carbamoyl]phenyl]-2,2-dimethylpropanamide (PubChem CID 134027331) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is N-[3-[[[2-(1-adamantyl)acetyl]amino]carbamoyl]phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-[[[2-(1-adamantyl)acetyl]amino]carbamoyl]phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 134027331 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | N-[3-[[[2-(1-adamantyl)acetyl]amino]carbamoyl]phenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1cccc(C(=O)NNC(=O)CC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C24H33N3O3/c1-23(2,3)22(30)25-19-6-4-5-18(10-19)21(29)27-26-20(28)14-24-11-15-7-16(12-24)9-17(8-15)13-24/h4-6,10,15-17H,7-9,11-14H2,1-3H3,(H,25,30)(H,26,28)(H,27,29) |
| InChIKey | ORBYVFDXMMWOPW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|