C21H28N2O4 — CID 7742291
N'-[2-(1-adamantyl)acetyl]-3,5-dimethoxybenzohydrazide (PubChem CID 7742291) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is N'-[2-(1-adamantyl)acetyl]-3,5-dimethoxybenzohydrazide.
| Compound Name | N'-[2-(1-adamantyl)acetyl]-3,5-dimethoxybenzohydrazide |
|---|---|
| PubChem CID | 7742291 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N'-[2-(1-adamantyl)acetyl]-3,5-dimethoxybenzohydrazide |
| SMILES | COc1cc(OC)cc(C(=O)NNC(=O)CC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C21H28N2O4/c1-26-17-6-16(7-18(8-17)27-2)20(25)23-22-19(24)12-21-9-13-3-14(10-21)5-15(4-13)11-21/h6-8,13-15H,3-5,9-12H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | GRDHABWGYRDDHC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|