C24H33N3O6 — CID 27562092
N-[2-[2-[2-(1-adamantyl)acetyl]hydrazinyl]-2-oxoethyl]-3,4,5-trimethoxybenzamide (PubChem CID 27562092) has the molecular formula C24H33N3O6 and a molecular weight of 459.54 g/mol. Its IUPAC name is N-[2-[2-[2-(1-adamantyl)acetyl]hydrazinyl]-2-oxoethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-[2-[2-(1-adamantyl)acetyl]hydrazinyl]-2-oxoethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 27562092 |
| Molecular Formula | C24H33N3O6 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | N-[2-[2-[2-(1-adamantyl)acetyl]hydrazinyl]-2-oxoethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(=O)NNC(=O)CC23CC4CC(CC(C4)C2)C3)cc(OC)c1OC |
| InChI | InChI=1S/C24H33N3O6/c1-31-18-7-17(8-19(32-2)22(18)33-3)23(30)25-13-21(29)27-26-20(28)12-24-9-14-4-15(10-24)6-16(5-14)11-24/h7-8,14-16H,4-6,9-13H2,1-3H3,(H,25,30)(H,26,28)(H,27,29) |
| InChIKey | JLSHUBZWHAYVEL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|