C23H32N2O4 — CID 9086066
N'-[2-(1-adamantyl)acetyl]-3-(3,5-dimethoxyphenyl)propanehydrazide (PubChem CID 9086066) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is N'-[2-(1-adamantyl)acetyl]-3-(3,5-dimethoxyphenyl)propanehydrazide.
| Compound Name | N'-[2-(1-adamantyl)acetyl]-3-(3,5-dimethoxyphenyl)propanehydrazide |
|---|---|
| PubChem CID | 9086066 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | N'-[2-(1-adamantyl)acetyl]-3-(3,5-dimethoxyphenyl)propanehydrazide |
| SMILES | COc1cc(CCC(=O)NNC(=O)CC23CC4CC(CC(C4)C2)C3)cc(OC)c1 |
| InChI | InChI=1S/C23H32N2O4/c1-28-19-8-15(9-20(10-19)29-2)3-4-21(26)24-25-22(27)14-23-11-16-5-17(12-23)7-18(6-16)13-23/h8-10,16-18H,3-7,11-14H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | UOALQKVMYNVEMX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|