C17H24N2O6S — CID 46463274
3-(3,5-dimethoxyphenyl)-N'-[2-(1,1-dioxothiolan-3-yl)acetyl]propanehydrazide (PubChem CID 46463274) has the molecular formula C17H24N2O6S and a molecular weight of 384.45 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-N'-[2-(1,1-dioxothiolan-3-yl)acetyl]propanehydrazide.
| Compound Name | 3-(3,5-dimethoxyphenyl)-N'-[2-(1,1-dioxothiolan-3-yl)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 46463274 |
| Molecular Formula | C17H24N2O6S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-N'-[2-(1,1-dioxothiolan-3-yl)acetyl]propanehydrazide |
| SMILES | COc1cc(CCC(=O)NNC(=O)CC2CCS(=O)(=O)C2)cc(OC)c1 |
| InChI | InChI=1S/C17H24N2O6S/c1-24-14-7-12(8-15(10-14)25-2)3-4-16(20)18-19-17(21)9-13-5-6-26(22,23)11-13/h7-8,10,13H,3-6,9,11H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | WVOZGLBFERWPEA-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|