C18H26N2O6S — CID 8938936
4-butoxy-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]-3-methoxybenzohydrazide (PubChem CID 8938936) has the molecular formula C18H26N2O6S and a molecular weight of 398.48 g/mol. Its IUPAC name is 4-butoxy-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]-3-methoxybenzohydrazide.
| Compound Name | 4-butoxy-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]-3-methoxybenzohydrazide |
|---|---|
| PubChem CID | 8938936 |
| Molecular Formula | C18H26N2O6S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 4-butoxy-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]-3-methoxybenzohydrazide |
| SMILES | CCCCOc1ccc(C(=O)NNC(=O)C[C@@H]2CCS(=O)(=O)C2)cc1OC |
| InChI | InChI=1S/C18H26N2O6S/c1-3-4-8-26-15-6-5-14(11-16(15)25-2)18(22)20-19-17(21)10-13-7-9-27(23,24)12-13/h5-6,11,13H,3-4,7-10,12H2,1-2H3,(H,19,21)(H,20,22)/t13-/m0/s1 |
| InChIKey | QRDHTKRHIVSVKX-ZDUSSCGKSA-N |
| XLogP | 1.46 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|