C21H31N3O5 — CID 24553492
N-[2-[2-(4-butoxy-3-methoxybenzoyl)hydrazinyl]-2-oxoethyl]cyclohexanecarboxamide (PubChem CID 24553492) has the molecular formula C21H31N3O5 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[2-[2-(4-butoxy-3-methoxybenzoyl)hydrazinyl]-2-oxoethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[2-(4-butoxy-3-methoxybenzoyl)hydrazinyl]-2-oxoethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 24553492 |
| Molecular Formula | C21H31N3O5 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | N-[2-[2-(4-butoxy-3-methoxybenzoyl)hydrazinyl]-2-oxoethyl]cyclohexanecarboxamide |
| SMILES | CCCCOc1ccc(C(=O)NNC(=O)CNC(=O)C2CCCCC2)cc1OC |
| InChI | InChI=1S/C21H31N3O5/c1-3-4-12-29-17-11-10-16(13-18(17)28-2)21(27)24-23-19(25)14-22-20(26)15-8-6-5-7-9-15/h10-11,13,15H,3-9,12,14H2,1-2H3,(H,22,26)(H,23,25)(H,24,27) |
| InChIKey | WTHRMOYMEKJJDN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|