C21H29NO6 — CID 55306524
[2-(cyclohexanecarbonylamino)-2-oxoethyl] 4-butoxy-3-methoxybenzoate (PubChem CID 55306524) has the molecular formula C21H29NO6 and a molecular weight of 391.46 g/mol. Its IUPAC name is [2-(cyclohexanecarbonylamino)-2-oxoethyl] 4-butoxy-3-methoxybenzoate.
| Compound Name | [2-(cyclohexanecarbonylamino)-2-oxoethyl] 4-butoxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 55306524 |
| Molecular Formula | C21H29NO6 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | [2-(cyclohexanecarbonylamino)-2-oxoethyl] 4-butoxy-3-methoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)OCC(=O)NC(=O)C2CCCCC2)cc1OC |
| InChI | InChI=1S/C21H29NO6/c1-3-4-12-27-17-11-10-16(13-18(17)26-2)21(25)28-14-19(23)22-20(24)15-8-6-5-7-9-15/h10-11,13,15H,3-9,12,14H2,1-2H3,(H,22,23,24) |
| InChIKey | GHJHKJKPHDHFSA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|