C19H29NO3 — CID 9404491
4-butoxy-3-methoxy-N-[(1S,2R)-2-methylcyclohexyl]benzamide (PubChem CID 9404491) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is 4-butoxy-3-methoxy-N-[(1S,2R)-2-methylcyclohexyl]benzamide.
| Compound Name | 4-butoxy-3-methoxy-N-[(1S,2R)-2-methylcyclohexyl]benzamide |
|---|---|
| PubChem CID | 9404491 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 4-butoxy-3-methoxy-N-[(1S,2R)-2-methylcyclohexyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)N[C@H]2CCCC[C@H]2C)cc1OC |
| InChI | InChI=1S/C19H29NO3/c1-4-5-12-23-17-11-10-15(13-18(17)22-3)19(21)20-16-9-7-6-8-14(16)2/h10-11,13-14,16H,4-9,12H2,1-3H3,(H,20,21)/t14-,16+/m1/s1 |
| InChIKey | TYCCVSRJAQPYFJ-ZBFHGGJFSA-N |
| XLogP | 4.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|